C34H24F6O6 — CID 134505177
6-(4-tert-butylphenyl)-7-[2-[(6-ethynoxy-1,3-benzodioxol-5-yl)methyl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]furo[2,3-f][1,3]benzodioxole (PubChem CID 134505177) has the molecular formula C34H24F6O6 and a molecular weight of 642.55 g/mol. Its IUPAC name is 6-(4-tert-butylphenyl)-7-[2-[(6-ethynoxy-1,3-benzodioxol-5-yl)methyl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]furo[2,3-f][1,3]benzodioxole.
| Compound Name | 6-(4-tert-butylphenyl)-7-[2-[(6-ethynoxy-1,3-benzodioxol-5-yl)methyl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]furo[2,3-f][1,3]benzodioxole |
|---|---|
| PubChem CID | 134505177 |
| Molecular Formula | C34H24F6O6 |
| Molecular Weight | 642.55 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | 6-(4-tert-butylphenyl)-7-[2-[(6-ethynoxy-1,3-benzodioxol-5-yl)methyl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]furo[2,3-f][1,3]benzodioxole |
| SMILES | C#COc1cc2c(cc1CC1=C(c3c(-c4ccc(C(C)(C)C)cc4)oc4cc5c(cc34)OCO5)C(F)(F)C(F)(F)C1(F)F)OCO2 |
| InChI | InChI=1S/C34H24F6O6/c1-5-41-22-13-26-24(42-15-44-26)11-18(22)10-21-29(33(37,38)34(39,40)32(21,35)36)28-20-12-25-27(45-16-43-25)14-23(20)46-30(28)17-6-8-19(9-7-17)31(2,3)4/h1,6-9,11-14H,10,15-16H2,2-4H3 |
| InChIKey | QOEXTKWSENLTJG-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.55 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|