About 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine
5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine (PubChem CID 134505269) has the molecular formula C30H26N3P
and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine.
Molecular Properties
| Compound Name | 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine |
| PubChem CID | 134505269 |
| Molecular Formula | C30H26N3P |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine |
| SMILES | Nc1cc(N)cc(-c2ccc(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C30H26N3P/c31-25-20-24(21-26(32)22-25)23-16-18-27(19-17-23)33-34(28-10-4-1-5-11-28,29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-22H,31-32H2 |
| InChIKey | WNWQKENBIYNYDQ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine?
The IUPAC name of 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine (CID 134505269) is 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine.
What is the SMILES notation for 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine?
The canonical SMILES for 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine is Nc1cc(N)cc(-c2ccc(N=P(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)c1.
What is the InChIKey of 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine?
The InChIKey is WNWQKENBIYNYDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H26N3P/c31-25-20-24(21-26(32)22-25)23-16-18-27(19-17-23)33-34(28-10-4-1-5-11-28,29-12-6-2-7-13-29)30-14-8-3-9-15-30/h1-22H,31-32H2.
What are the key properties of 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine?
5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine has a molecular weight of 459.53 g/mol, XLogP of 6.33, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-[(triphenyl-λ5-phosphanylidene)amino]phenyl]benzene-1,3-diamine is sourced from PubChem (CID 134505269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).