C20H40N4O2 — CID 134505512
tert-butyl N-[4-[(4-ethylpiperazin-1-yl)methyl]-1-propan-2-ylpiperidin-4-yl]carbamate (PubChem CID 134505512) has the molecular formula C20H40N4O2 and a molecular weight of 368.57 g/mol. Its IUPAC name is tert-butyl N-[4-[(4-ethylpiperazin-1-yl)methyl]-1-propan-2-ylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[4-[(4-ethylpiperazin-1-yl)methyl]-1-propan-2-ylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 134505512 |
| Molecular Formula | C20H40N4O2 |
| Molecular Weight | 368.57 g/mol |
| Exact Mass | 368.32 |
| IUPAC Name | tert-butyl N-[4-[(4-ethylpiperazin-1-yl)methyl]-1-propan-2-ylpiperidin-4-yl]carbamate |
| SMILES | CCN1CCN(CC2(NC(=O)OC(C)(C)C)CCN(C(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H40N4O2/c1-7-22-12-14-23(15-13-22)16-20(21-18(25)26-19(4,5)6)8-10-24(11-9-20)17(2)3/h17H,7-16H2,1-6H3,(H,21,25) |
| InChIKey | UYFIMTQTMWWYPK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |