C25H27F6NO3 — CID 134506858
tert-butyl (3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate (PubChem CID 134506858) has the molecular formula C25H27F6NO3 and a molecular weight of 503.48 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134506858 |
| Molecular Formula | C25H27F6NO3 |
| Molecular Weight | 503.48 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | tert-butyl (3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@@](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C25H27F6NO3/c1-21(2,3)35-20(33)32-14-19(22(4,15-32)17-8-6-5-7-9-17)16-10-12-18(13-11-16)23(34,24(26,27)28)25(29,30)31/h5-13,19,34H,14-15H2,1-4H3/t19-,22+/m0/s1 |
| InChIKey | YVWVAXBJCPBFBV-SIKLNZKXSA-N |
| XLogP | 6.29 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |