C19H16F6N4O — CID 134506920
2-[(3S,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-methylpyrrolidin-1-yl]pyrimidine-5-carbonitrile (PubChem CID 134506920) has the molecular formula C19H16F6N4O and a molecular weight of 430.35 g/mol. Its IUPAC name is 2-[(3S,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-methylpyrrolidin-1-yl]pyrimidine-5-carbonitrile.
| Compound Name | 2-[(3S,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-methylpyrrolidin-1-yl]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 134506920 |
| Molecular Formula | C19H16F6N4O |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | 2-[(3S,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-methylpyrrolidin-1-yl]pyrimidine-5-carbonitrile |
| SMILES | C[C@H]1CN(c2ncc(C#N)cn2)C[C@@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F6N4O/c1-11-9-29(16-27-7-12(6-26)8-28-16)10-15(11)13-2-4-14(5-3-13)17(30,18(20,21)22)19(23,24)25/h2-5,7-8,11,15,30H,9-10H2,1H3/t11-,15-/m0/s1 |
| InChIKey | OUOXXGXSZWNKCY-NHYWBVRUSA-N |
| XLogP | 3.90 |
| TPSA | 73.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |