C24H25F6NO — CID 134506950
2-[4-[(3S,4S)-1-(cyclopropylmethyl)-4-methyl-4-phenylpyrrolidin-3-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 134506950) has the molecular formula C24H25F6NO and a molecular weight of 457.46 g/mol. Its IUPAC name is 2-[4-[(3S,4S)-1-(cyclopropylmethyl)-4-methyl-4-phenylpyrrolidin-3-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[(3S,4S)-1-(cyclopropylmethyl)-4-methyl-4-phenylpyrrolidin-3-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 134506950 |
| Molecular Formula | C24H25F6NO |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | 2-[4-[(3S,4S)-1-(cyclopropylmethyl)-4-methyl-4-phenylpyrrolidin-3-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C[C@]1(c2ccccc2)CN(CC2CC2)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H25F6NO/c1-21(18-5-3-2-4-6-18)15-31(13-16-7-8-16)14-20(21)17-9-11-19(12-10-17)22(32,23(25,26)27)24(28,29)30/h2-6,9-12,16,20,32H,7-8,13-15H2,1H3/t20-,21+/m0/s1 |
| InChIKey | OBWJOIZOWSANIF-LEWJYISDSA-N |
| XLogP | 5.77 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |