C22H21F6NO2 — CID 134506953
1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]ethanone (PubChem CID 134506953) has the molecular formula C22H21F6NO2 and a molecular weight of 445.40 g/mol. Its IUPAC name is 1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]ethanone.
| Compound Name | 1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 134506953 |
| Molecular Formula | C22H21F6NO2 |
| Molecular Weight | 445.40 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-[(3S,4S)-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methyl-3-phenylpyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1C[C@@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)[C@@](C)(c2ccccc2)C1 |
| InChI | InChI=1S/C22H21F6NO2/c1-14(30)29-12-18(19(2,13-29)16-6-4-3-5-7-16)15-8-10-17(11-9-15)20(31,21(23,24)25)22(26,27)28/h3-11,18,31H,12-13H2,1-2H3/t18-,19+/m0/s1 |
| InChIKey | AUXZEIGUWQDCNZ-RBUKOAKNSA-N |
| XLogP | 4.90 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.40 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |