C24H25F6NO3 — CID 134506969
tert-butyl (3R,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-phenylpyrrolidine-1-carboxylate (PubChem CID 134506969) has the molecular formula C24H25F6NO3 and a molecular weight of 489.46 g/mol. Its IUPAC name is tert-butyl (3R,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3R,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134506969 |
| Molecular Formula | C24H25F6NO3 |
| Molecular Weight | 489.46 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | tert-butyl (3R,4R)-3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-phenylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](c2ccccc2)[C@H](c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C24H25F6NO3/c1-21(2,3)34-20(32)31-13-18(15-7-5-4-6-8-15)19(14-31)16-9-11-17(12-10-16)22(33,23(25,26)27)24(28,29)30/h4-12,18-19,33H,13-14H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | XSUUHMZKQJKLGH-OALUTQOASA-N |
| XLogP | 6.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |