C26H29F6NO3 — CID 134506972
tert-butyl (3S,4S)-3-ethyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-phenylpyrrolidine-1-carboxylate (PubChem CID 134506972) has the molecular formula C26H29F6NO3 and a molecular weight of 517.51 g/mol. Its IUPAC name is tert-butyl (3S,4S)-3-ethyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-phenylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-3-ethyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134506972 |
| Molecular Formula | C26H29F6NO3 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | tert-butyl (3S,4S)-3-ethyl-4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-phenylpyrrolidine-1-carboxylate |
| SMILES | CC[C@]1(c2ccccc2)CN(C(=O)OC(C)(C)C)C[C@H]1c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C26H29F6NO3/c1-5-23(18-9-7-6-8-10-18)16-33(21(34)36-22(2,3)4)15-20(23)17-11-13-19(14-12-17)24(35,25(27,28)29)26(30,31)32/h6-14,20,35H,5,15-16H2,1-4H3/t20-,23+/m0/s1 |
| InChIKey | YMHSHFHWZNYMCI-NZQKXSOJSA-N |
| XLogP | 6.68 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |