C30H15F2NO2S2 — CID 134507023
5,6-difluoro-2-[[5-(4-phenylthieno[2,3-b]indol-2-yl)thiophen-2-yl]methylidene]indene-1,3-dione (PubChem CID 134507023) has the molecular formula C30H15F2NO2S2 and a molecular weight of 523.59 g/mol. Its IUPAC name is 5,6-difluoro-2-[[5-(4-phenylthieno[2,3-b]indol-2-yl)thiophen-2-yl]methylidene]indene-1,3-dione.
| Compound Name | 5,6-difluoro-2-[[5-(4-phenylthieno[2,3-b]indol-2-yl)thiophen-2-yl]methylidene]indene-1,3-dione |
|---|---|
| PubChem CID | 134507023 |
| Molecular Formula | C30H15F2NO2S2 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.05 |
| IUPAC Name | 5,6-difluoro-2-[[5-(4-phenylthieno[2,3-b]indol-2-yl)thiophen-2-yl]methylidene]indene-1,3-dione |
| SMILES | O=C1C(=Cc2ccc(-c3cc4c5ccccc5n(-c5ccccc5)c4s3)s2)C(=O)c2cc(F)c(F)cc21 |
| InChI | InChI=1S/C30H15F2NO2S2/c31-23-13-19-20(14-24(23)32)29(35)22(28(19)34)12-17-10-11-26(36-17)27-15-21-18-8-4-5-9-25(18)33(30(21)37-27)16-6-2-1-3-7-16/h1-15H |
| InChIKey | UBYPESOCPPKIOX-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|