C17H27NO2 — CID 134507138
1-(2,4,4,6-tetramethyl-5-oxoheptan-2-yl)-4H-azepin-7-one (PubChem CID 134507138) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-(2,4,4,6-tetramethyl-5-oxoheptan-2-yl)-4H-azepin-7-one.
| Compound Name | 1-(2,4,4,6-tetramethyl-5-oxoheptan-2-yl)-4H-azepin-7-one |
|---|---|
| PubChem CID | 134507138 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 1-(2,4,4,6-tetramethyl-5-oxoheptan-2-yl)-4H-azepin-7-one |
| SMILES | CC(C)C(=O)C(C)(C)CC(C)(C)N1C=CCC=CC1=O |
| InChI | InChI=1S/C17H27NO2/c1-13(2)15(20)16(3,4)12-17(5,6)18-11-9-7-8-10-14(18)19/h8-11,13H,7,12H2,1-6H3 |
| InChIKey | VVBDTQIAPRXRSL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |