C45H84N4O — CID 134507540
4-(4-methylpiperazin-1-yl)-N',N'-bis[(9Z,12Z)-octadeca-9,12-dienyl]butanehydrazide (PubChem CID 134507540) has the molecular formula C45H84N4O and a molecular weight of 697.19 g/mol. Its IUPAC name is 4-(4-methylpiperazin-1-yl)-N',N'-bis[(9Z,12Z)-octadeca-9,12-dienyl]butanehydrazide.
| Compound Name | 4-(4-methylpiperazin-1-yl)-N',N'-bis[(9Z,12Z)-octadeca-9,12-dienyl]butanehydrazide |
|---|---|
| PubChem CID | 134507540 |
| Molecular Formula | C45H84N4O |
| Molecular Weight | 697.19 g/mol |
| Exact Mass | 696.66 |
| IUPAC Name | 4-(4-methylpiperazin-1-yl)-N',N'-bis[(9Z,12Z)-octadeca-9,12-dienyl]butanehydrazide |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCN(CCCCCCCC/C=C\C/C=C\CCCCC)NC(=O)CCCN1CCN(C)CC1 |
| InChI | InChI=1S/C45H84N4O/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-39-49(46-45(50)37-36-38-48-43-41-47(3)42-44-48)40-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2/h12-15,18-21H,4-11,16-17,22-44H2,1-3H3,(H,46,50)/b14-12-,15-13-,20-18-,21-19- |
| InChIKey | QMYTZWYEBXYCPO-QYCRHRGJSA-N |
| XLogP | 11.97 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.19 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|