C11H9N3 — CID 134507666
4,6,11-triazatricyclo[7.3.1.13,7]tetradeca-1(13),3(14),4,6,9,11-hexaene (PubChem CID 134507666) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 4,6,11-triazatricyclo[7.3.1.13,7]tetradeca-1(13),3(14),4,6,9,11-hexaene.
| Compound Name | 4,6,11-triazatricyclo[7.3.1.13,7]tetradeca-1(13),3(14),4,6,9,11-hexaene |
|---|---|
| PubChem CID | 134507666 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 4,6,11-triazatricyclo[7.3.1.13,7]tetradeca-1(13),3(14),4,6,9,11-hexaene |
| SMILES | c1nc2cc(n1)Cc1cncc(c1)C2 |
| InChI | InChI=1S/C11H9N3/c1-8-2-10-4-11(14-7-13-10)3-9(1)6-12-5-8/h1,4-7H,2-3H2 |
| InChIKey | KKXCRZSEENDHHX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |