C11H9N3 — CID 134507697
5,13,14-triazatricyclo[7.3.1.13,7]tetradeca-1(13),3,5,7(14),9,11-hexaene (PubChem CID 134507697) has the molecular formula C11H9N3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 5,13,14-triazatricyclo[7.3.1.13,7]tetradeca-1(13),3,5,7(14),9,11-hexaene.
| Compound Name | 5,13,14-triazatricyclo[7.3.1.13,7]tetradeca-1(13),3,5,7(14),9,11-hexaene |
|---|---|
| PubChem CID | 134507697 |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 5,13,14-triazatricyclo[7.3.1.13,7]tetradeca-1(13),3,5,7(14),9,11-hexaene |
| SMILES | c1cc2nc(c1)Cc1cncc(n1)C2 |
| InChI | InChI=1S/C11H9N3/c1-2-8-4-10-6-12-7-11(14-10)5-9(3-1)13-8/h1-3,6-7H,4-5H2 |
| InChIKey | SEKMKQLPPYTSTF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |