About 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine
2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine (PubChem CID 13450837) has the molecular formula C16H17N3OS
and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine |
| PubChem CID | 13450837 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine |
| SMILES | CCCOc1cc(SC)ccc1-c1nc2ccncc2[nH]1 |
| InChI | InChI=1S/C16H17N3OS/c1-3-8-20-15-9-11(21-2)4-5-12(15)16-18-13-6-7-17-10-14(13)19-16/h4-7,9-10H,3,8H2,1-2H3,(H,18,19) |
| InChIKey | KWDCJYKAFCWWMI-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine?
The IUPAC name of 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine (CID 13450837) is 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine.
What is the SMILES notation for 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine?
The canonical SMILES for 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine is CCCOc1cc(SC)ccc1-c1nc2ccncc2[nH]1.
What is the InChIKey of 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine?
The InChIKey is KWDCJYKAFCWWMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3OS/c1-3-8-20-15-9-11(21-2)4-5-12(15)16-18-13-6-7-17-10-14(13)19-16/h4-7,9-10H,3,8H2,1-2H3,(H,18,19).
What are the key properties of 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine?
2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine has a molecular weight of 299.40 g/mol, XLogP of 4.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methylsulfanyl-2-propoxyphenyl)-3H-imidazo[4,5-c]pyridine is sourced from PubChem (CID 13450837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).