C17H26O4 — CID 134509276
methyl 1',2',4,5-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene]-3'a-carboxylate (PubChem CID 134509276) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 1',2',4,5-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene]-3'a-carboxylate.
| Compound Name | methyl 1',2',4,5-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene]-3'a-carboxylate |
|---|---|
| PubChem CID | 134509276 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl 1',2',4,5-tetramethylspiro[1,3-dioxolane-2,6'-2,3,4,5-tetrahydro-1H-indene]-3'a-carboxylate |
| SMILES | COC(=O)C12CCC3(C=C1C(C)C(C)C2)OC(C)C(C)O3 |
| InChI | InChI=1S/C17H26O4/c1-10-8-16(15(18)19-5)6-7-17(9-14(16)11(10)2)20-12(3)13(4)21-17/h9-13H,6-8H2,1-5H3 |
| InChIKey | NVTUKSQVELOAMW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|