About 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate
1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate (PubChem CID 134509427) has the molecular formula C24H29NO6
and a molecular weight of 427.50 g/mol. Its IUPAC name is 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate.
Molecular Properties
| Compound Name | 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate |
| PubChem CID | 134509427 |
| Molecular Formula | C24H29NO6 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate |
| SMILES | CCOC(=O)OC(C)OC(=O)CCCN(Cc1ccccc1)c1cc(C)ccc1C=O |
| InChI | InChI=1S/C24H29NO6/c1-4-29-24(28)31-19(3)30-23(27)11-8-14-25(16-20-9-6-5-7-10-20)22-15-18(2)12-13-21(22)17-26/h5-7,9-10,12-13,15,17,19H,4,8,11,14,16H2,1-3H3 |
| InChIKey | HBHHOOJCOKJGHU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate?
The IUPAC name of 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate (CID 134509427) is 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate.
What is the SMILES notation for 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate?
The canonical SMILES for 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate is CCOC(=O)OC(C)OC(=O)CCCN(Cc1ccccc1)c1cc(C)ccc1C=O.
What is the InChIKey of 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate?
The InChIKey is HBHHOOJCOKJGHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29NO6/c1-4-29-24(28)31-19(3)30-23(27)11-8-14-25(16-20-9-6-5-7-10-20)22-15-18(2)12-13-21(22)17-26/h5-7,9-10,12-13,15,17,19H,4,8,11,14,16H2,1-3H3.
What are the key properties of 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate?
1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate has a molecular weight of 427.50 g/mol, XLogP of 4.66, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxycarbonyloxyethyl 4-(N-benzyl-2-formyl-5-methylanilino)butanoate is sourced from PubChem (CID 134509427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).