About N-tert-butyl-N,1-dimethylazetidine-2-carboxamide
N-tert-butyl-N,1-dimethylazetidine-2-carboxamide (PubChem CID 134509557) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is N-tert-butyl-N,1-dimethylazetidine-2-carboxamide.
Molecular Properties
| Compound Name | N-tert-butyl-N,1-dimethylazetidine-2-carboxamide |
| PubChem CID | 134509557 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N-tert-butyl-N,1-dimethylazetidine-2-carboxamide |
| SMILES | CN1CCC1C(=O)N(C)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O/c1-10(2,3)12(5)9(13)8-6-7-11(8)4/h8H,6-7H2,1-5H3 |
| InChIKey | FHYCHTUHWZLELC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-N,1-dimethylazetidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-N,1-dimethylazetidine-2-carboxamide?
The IUPAC name of N-tert-butyl-N,1-dimethylazetidine-2-carboxamide (CID 134509557) is N-tert-butyl-N,1-dimethylazetidine-2-carboxamide.
What is the SMILES notation for N-tert-butyl-N,1-dimethylazetidine-2-carboxamide?
The canonical SMILES for N-tert-butyl-N,1-dimethylazetidine-2-carboxamide is CN1CCC1C(=O)N(C)C(C)(C)C.
What is the InChIKey of N-tert-butyl-N,1-dimethylazetidine-2-carboxamide?
The InChIKey is FHYCHTUHWZLELC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O/c1-10(2,3)12(5)9(13)8-6-7-11(8)4/h8H,6-7H2,1-5H3.
What are the key properties of N-tert-butyl-N,1-dimethylazetidine-2-carboxamide?
N-tert-butyl-N,1-dimethylazetidine-2-carboxamide has a molecular weight of 184.28 g/mol, XLogP of 0.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-N,1-dimethylazetidine-2-carboxamide is sourced from PubChem (CID 134509557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).