C12H19F3N2 — CID 134509600
4-butan-2-yl-1-(5,5,5-trifluoropentyl)pyrazole (PubChem CID 134509600) has the molecular formula C12H19F3N2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-butan-2-yl-1-(5,5,5-trifluoropentyl)pyrazole.
| Compound Name | 4-butan-2-yl-1-(5,5,5-trifluoropentyl)pyrazole |
|---|---|
| PubChem CID | 134509600 |
| Molecular Formula | C12H19F3N2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 4-butan-2-yl-1-(5,5,5-trifluoropentyl)pyrazole |
| SMILES | CCC(C)c1cnn(CCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H19F3N2/c1-3-10(2)11-8-16-17(9-11)7-5-4-6-12(13,14)15/h8-10H,3-7H2,1-2H3 |
| InChIKey | WXTAIWQNESWFLT-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|