C9H12F6O — CID 13451014
2-(1,1,2,3,3,3-hexafluoropropyl)oxepane (PubChem CID 13451014) has the molecular formula C9H12F6O and a molecular weight of 250.18 g/mol. Its IUPAC name is 2-(1,1,2,3,3,3-hexafluoropropyl)oxepane.
| Compound Name | 2-(1,1,2,3,3,3-hexafluoropropyl)oxepane |
|---|---|
| PubChem CID | 13451014 |
| Molecular Formula | C9H12F6O |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-(1,1,2,3,3,3-hexafluoropropyl)oxepane |
| SMILES | FC(C(F)(F)F)C(F)(F)C1CCCCCO1 |
| InChI | InChI=1S/C9H12F6O/c10-7(9(13,14)15)8(11,12)6-4-2-1-3-5-16-6/h6-7H,1-5H2 |
| InChIKey | BVBSXBCUWFCNPN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |