About 1,1-dichlorothiolane
1,1-dichlorothiolane (PubChem CID 13451032) has the molecular formula C4H8Cl2S
and a molecular weight of 159.08 g/mol. Its IUPAC name is 1,1-dichlorothiolane.
Molecular Properties
| Compound Name | 1,1-dichlorothiolane |
| PubChem CID | 13451032 |
| Molecular Formula | C4H8Cl2S |
| Molecular Weight | 159.08 g/mol |
| Exact Mass | 157.97 |
| IUPAC Name | 1,1-dichlorothiolane |
| SMILES | ClS1(Cl)CCCC1 |
| InChI | InChI=1S/C4H8Cl2S/c5-7(6)3-1-2-4-7/h1-4H2 |
| InChIKey | GHUGWQHSCMJSPS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.08 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-dichlorothiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichlorothiolane?
The IUPAC name of 1,1-dichlorothiolane (CID 13451032) is 1,1-dichlorothiolane.
What is the SMILES notation for 1,1-dichlorothiolane?
The canonical SMILES for 1,1-dichlorothiolane is ClS1(Cl)CCCC1.
What is the InChIKey of 1,1-dichlorothiolane?
The InChIKey is GHUGWQHSCMJSPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8Cl2S/c5-7(6)3-1-2-4-7/h1-4H2.
What are the key properties of 1,1-dichlorothiolane?
1,1-dichlorothiolane has a molecular weight of 159.08 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichlorothiolane is sourced from PubChem (CID 13451032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).