C33H36O4 — CID 134510323
3-[5-[5-hydroxy-2-(4-methylphenyl)phenyl]-3,3-dimethoxypentyl]-4-(4-methylphenyl)phenol (PubChem CID 134510323) has the molecular formula C33H36O4 and a molecular weight of 496.65 g/mol. Its IUPAC name is 3-[5-[5-hydroxy-2-(4-methylphenyl)phenyl]-3,3-dimethoxypentyl]-4-(4-methylphenyl)phenol.
| Compound Name | 3-[5-[5-hydroxy-2-(4-methylphenyl)phenyl]-3,3-dimethoxypentyl]-4-(4-methylphenyl)phenol |
|---|---|
| PubChem CID | 134510323 |
| Molecular Formula | C33H36O4 |
| Molecular Weight | 496.65 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 3-[5-[5-hydroxy-2-(4-methylphenyl)phenyl]-3,3-dimethoxypentyl]-4-(4-methylphenyl)phenol |
| SMILES | COC(CCc1cc(O)ccc1-c1ccc(C)cc1)(CCc1cc(O)ccc1-c1ccc(C)cc1)OC |
| InChI | InChI=1S/C33H36O4/c1-23-5-9-25(10-6-23)31-15-13-29(34)21-27(31)17-19-33(36-3,37-4)20-18-28-22-30(35)14-16-32(28)26-11-7-24(2)8-12-26/h5-16,21-22,34-35H,17-20H2,1-4H3 |
| InChIKey | RCDGJFOSFNUQGS-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.65 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|