C19H19ClO2 — CID 134510388
(6aS,12bS)-4-chloro-9-methyl-5,6,6a,7,8,12b-hexahydrobenzo[c]phenanthrene-1,12-diol (PubChem CID 134510388) has the molecular formula C19H19ClO2 and a molecular weight of 314.81 g/mol. Its IUPAC name is (6aS,12bS)-4-chloro-9-methyl-5,6,6a,7,8,12b-hexahydrobenzo[c]phenanthrene-1,12-diol.
| Compound Name | (6aS,12bS)-4-chloro-9-methyl-5,6,6a,7,8,12b-hexahydrobenzo[c]phenanthrene-1,12-diol |
|---|---|
| PubChem CID | 134510388 |
| Molecular Formula | C19H19ClO2 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | (6aS,12bS)-4-chloro-9-methyl-5,6,6a,7,8,12b-hexahydrobenzo[c]phenanthrene-1,12-diol |
| SMILES | Cc1ccc(O)c2c1CC[C@H]1CCc3c(Cl)ccc(O)c3[C@H]21 |
| InChI | InChI=1S/C19H19ClO2/c1-10-2-8-15(21)18-12(10)5-3-11-4-6-13-14(20)7-9-16(22)19(13)17(11)18/h2,7-9,11,17,21-22H,3-6H2,1H3/t11-,17-/m0/s1 |
| InChIKey | BCQFBSODJHMXKY-GTNSWQLSSA-N |
| XLogP | 4.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |