C25H34N2O6 — CID 134510484
[(2S,3S,7aS,12bS)-3-ethyl-2-[(E)-3-hydroxy-1,3-dimethoxyprop-1-en-2-yl]-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-7a-yl] acetate (PubChem CID 134510484) has the molecular formula C25H34N2O6 and a molecular weight of 458.56 g/mol. Its IUPAC name is [(2S,3S,7aS,12bS)-3-ethyl-2-[(E)-3-hydroxy-1,3-dimethoxyprop-1-en-2-yl]-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-7a-yl] acetate.
| Compound Name | [(2S,3S,7aS,12bS)-3-ethyl-2-[(E)-3-hydroxy-1,3-dimethoxyprop-1-en-2-yl]-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-7a-yl] acetate |
|---|---|
| PubChem CID | 134510484 |
| Molecular Formula | C25H34N2O6 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | [(2S,3S,7aS,12bS)-3-ethyl-2-[(E)-3-hydroxy-1,3-dimethoxyprop-1-en-2-yl]-8-methoxy-2,3,4,6,7,12b-hexahydro-1H-indolo[2,3-a]quinolizin-7a-yl] acetate |
| SMILES | CC[C@@H]1CN2CC[C@@]3(OC(C)=O)C(=Nc4cccc(OC)c43)[C@@H]2C[C@@H]1/C(=C\OC)C(O)OC |
| InChI | InChI=1S/C25H34N2O6/c1-6-16-13-27-11-10-25(33-15(2)28)22-19(8-7-9-21(22)31-4)26-23(25)20(27)12-17(16)18(14-30-3)24(29)32-5/h7-9,14,16-17,20,24,29H,6,10-13H2,1-5H3/b18-14+/t16-,17+,20+,24?,25+/m1/s1 |
| InChIKey | SPDWBOKRGIEAFP-AAEBNHBESA-N |
| XLogP | 3.16 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|