C18H26INO9S — CID 134511145
S-(methylaminooxy) 4-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5-iodo-2,3-dimethoxy-6-methylbenzenecarbothioate (PubChem CID 134511145) has the molecular formula C18H26INO9S and a molecular weight of 559.38 g/mol. Its IUPAC name is S-(methylaminooxy) 4-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5-iodo-2,3-dimethoxy-6-methylbenzenecarbothioate.
| Compound Name | S-(methylaminooxy) 4-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5-iodo-2,3-dimethoxy-6-methylbenzenecarbothioate |
|---|---|
| PubChem CID | 134511145 |
| Molecular Formula | C18H26INO9S |
| Molecular Weight | 559.38 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | S-(methylaminooxy) 4-(3,5-dihydroxy-4-methoxy-6-methyloxan-2-yl)oxy-5-iodo-2,3-dimethoxy-6-methylbenzenecarbothioate |
| SMILES | CNOSC(=O)c1c(C)c(I)c(OC2OC(C)C(O)C(OC)C2O)c(OC)c1OC |
| InChI | InChI=1S/C18H26INO9S/c1-7-9(17(23)30-29-20-3)13(24-4)16(26-6)14(10(7)19)28-18-12(22)15(25-5)11(21)8(2)27-18/h8,11-12,15,18,20-22H,1-6H3 |
| InChIKey | RVJUTJAGZRTODY-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|