C24H28N4O2 — CID 134511182
tert-butyl 2-[(4S)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetate (PubChem CID 134511182) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is tert-butyl 2-[(4S)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4S)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetate |
|---|---|
| PubChem CID | 134511182 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | tert-butyl 2-[(4S)-6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetate |
| SMILES | C=C/C=C(\C=C/C)C1=N[C@@H](CC(=O)OC(C)(C)C)c2nnc(C)n2-c2ccccc21 |
| InChI | InChI=1S/C24H28N4O2/c1-7-11-17(12-8-2)22-18-13-9-10-14-20(18)28-16(3)26-27-23(28)19(25-22)15-21(29)30-24(4,5)6/h7-14,19H,1,15H2,2-6H3/b12-8-,17-11+/t19-/m0/s1 |
| InChIKey | GSSOEJWWASNFLW-KFYHNMLXSA-N |
| XLogP | 4.84 |
| TPSA | 69.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|