C50H37NO — CID 134511638
9-(7,7-dimethylfluoreno[5,6-b][1]benzofuran-9-yl)-3-[(3Z,5E)-5-naphthalen-1-ylhepta-1,3,5-trien-2-yl]carbazole (PubChem CID 134511638) has the molecular formula C50H37NO and a molecular weight of 667.85 g/mol. Its IUPAC name is 9-(7,7-dimethylfluoreno[5,6-b][1]benzofuran-9-yl)-3-[(3Z,5E)-5-naphthalen-1-ylhepta-1,3,5-trien-2-yl]carbazole.
| Compound Name | 9-(7,7-dimethylfluoreno[5,6-b][1]benzofuran-9-yl)-3-[(3Z,5E)-5-naphthalen-1-ylhepta-1,3,5-trien-2-yl]carbazole |
|---|---|
| PubChem CID | 134511638 |
| Molecular Formula | C50H37NO |
| Molecular Weight | 667.85 g/mol |
| Exact Mass | 667.29 |
| IUPAC Name | 9-(7,7-dimethylfluoreno[5,6-b][1]benzofuran-9-yl)-3-[(3Z,5E)-5-naphthalen-1-ylhepta-1,3,5-trien-2-yl]carbazole |
| SMILES | C=C(/C=C\C(=C/C)c1cccc2ccccc12)c1ccc2c(c1)c1ccccc1n2-c1ccc2c(c1)C(C)(C)c1ccc3c(oc4ccccc43)c1-2 |
| InChI | InChI=1S/C50H37NO/c1-5-32(36-18-12-14-33-13-6-7-15-37(33)36)22-21-31(2)34-23-28-46-42(29-34)38-16-8-10-19-45(38)51(46)35-24-25-41-44(30-35)50(3,4)43-27-26-40-39-17-9-11-20-47(39)52-49(40)48(41)43/h5-30H,2H2,1,3-4H3/b22-21-,32-5+ |
| InChIKey | DAQBEMUMQSYATH-RXTVZWDESA-N |
| XLogP | 13.82 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.85 |
| LogP ≤ 5 | 13.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|