C15H18ClN5O2 — CID 134511926
4-N-(3-aminopropyl)-5-chloro-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-2,4-diamine (PubChem CID 134511926) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)-5-chloro-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminopropyl)-5-chloro-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134511926 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-N-(3-aminopropyl)-5-chloro-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrimidine-2,4-diamine |
| SMILES | NCCCNc1nc(Nc2ccc3c(c2)OCCO3)ncc1Cl |
| InChI | InChI=1S/C15H18ClN5O2/c16-11-9-19-15(21-14(11)18-5-1-4-17)20-10-2-3-12-13(8-10)23-7-6-22-12/h2-3,8-9H,1,4-7,17H2,(H2,18,19,20,21) |
| InChIKey | OFYQAVFEGWZUOW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|