C19H28ClN5 — CID 134511939
4-N-(3-aminopropyl)-5-chloro-2-N-(4-hexylphenyl)pyrimidine-2,4-diamine (PubChem CID 134511939) has the molecular formula C19H28ClN5 and a molecular weight of 361.92 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)-5-chloro-2-N-(4-hexylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminopropyl)-5-chloro-2-N-(4-hexylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134511939 |
| Molecular Formula | C19H28ClN5 |
| Molecular Weight | 361.92 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | 4-N-(3-aminopropyl)-5-chloro-2-N-(4-hexylphenyl)pyrimidine-2,4-diamine |
| SMILES | CCCCCCc1ccc(Nc2ncc(Cl)c(NCCCN)n2)cc1 |
| InChI | InChI=1S/C19H28ClN5/c1-2-3-4-5-7-15-8-10-16(11-9-15)24-19-23-14-17(20)18(25-19)22-13-6-12-21/h8-11,14H,2-7,12-13,21H2,1H3,(H2,22,23,24,25) |
| InChIKey | IUFVUIXKWVUXCQ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.92 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|