C16H21N5O2 — CID 134511991
4-N-(3-aminopropyl)-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylpyrimidine-2,4-diamine (PubChem CID 134511991) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 4-N-(3-aminopropyl)-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(3-aminopropyl)-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134511991 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 4-N-(3-aminopropyl)-2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylpyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2ccc3c(c2)OCCO3)nc1NCCCN |
| InChI | InChI=1S/C16H21N5O2/c1-11-10-19-16(21-15(11)18-6-2-5-17)20-12-3-4-13-14(9-12)23-8-7-22-13/h3-4,9-10H,2,5-8,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | ZBAMQJPQSMPECJ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|