C19H24N2 — CID 134512054
(2Z,6Z)-5-methylidene-N-[(2Z,4Z)-4-(prop-2-enylideneamino)hepta-2,4,6-trien-3-yl]octa-2,6-dien-4-imine (PubChem CID 134512054) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is (2Z,6Z)-5-methylidene-N-[(2Z,4Z)-4-(prop-2-enylideneamino)hepta-2,4,6-trien-3-yl]octa-2,6-dien-4-imine.
| Compound Name | (2Z,6Z)-5-methylidene-N-[(2Z,4Z)-4-(prop-2-enylideneamino)hepta-2,4,6-trien-3-yl]octa-2,6-dien-4-imine |
|---|---|
| PubChem CID | 134512054 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (2Z,6Z)-5-methylidene-N-[(2Z,4Z)-4-(prop-2-enylideneamino)hepta-2,4,6-trien-3-yl]octa-2,6-dien-4-imine |
| SMILES | C=C/C=C(\N=C\C=C)C(=C/C)/N=C(/C=C\C)C(=C)/C=C\C |
| InChI | InChI=1S/C19H24N2/c1-7-12-16(6)18(13-8-2)21-17(11-5)19(14-9-3)20-15-10-4/h7-15H,3-4,6H2,1-2,5H3/b12-7-,13-8-,17-11-,19-14-,20-15+,21-18+ |
| InChIKey | DUSJXNVCFFNCMD-LSTRHMKGSA-N |
| XLogP | 5.37 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|