C13H18N4 — CID 134512369
3-[(2E,4Z)-6-cyanohepta-2,4,6-trien-3-yl]-2-ethenyl-1,1-dimethylguanidine (PubChem CID 134512369) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[(2E,4Z)-6-cyanohepta-2,4,6-trien-3-yl]-2-ethenyl-1,1-dimethylguanidine.
| Compound Name | 3-[(2E,4Z)-6-cyanohepta-2,4,6-trien-3-yl]-2-ethenyl-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 134512369 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-[(2E,4Z)-6-cyanohepta-2,4,6-trien-3-yl]-2-ethenyl-1,1-dimethylguanidine |
| SMILES | C=C/N=C(/NC(/C=C\C(=C)C#N)=C/C)N(C)C |
| InChI | InChI=1S/C13H18N4/c1-6-12(9-8-11(3)10-14)16-13(15-7-2)17(4)5/h6-9H,2-3H2,1,4-5H3,(H,15,16)/b9-8-,12-6- |
| InChIKey | UZMNVNPOQYETNZ-GNXJPQOPSA-N |
| XLogP | 2.18 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|