C19H15F3N6O — CID 134512472
7-[5-amino-2-(2,4,6-trifluoroanilino)phenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one (PubChem CID 134512472) has the molecular formula C19H15F3N6O and a molecular weight of 400.36 g/mol. Its IUPAC name is 7-[5-amino-2-(2,4,6-trifluoroanilino)phenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one.
| Compound Name | 7-[5-amino-2-(2,4,6-trifluoroanilino)phenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one |
|---|---|
| PubChem CID | 134512472 |
| Molecular Formula | C19H15F3N6O |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 7-[5-amino-2-(2,4,6-trifluoroanilino)phenyl]-2,5-dimethyltriazolo[4,5-c]pyridin-4-one |
| SMILES | Cn1nc2c(-c3cc(N)ccc3Nc3c(F)cc(F)cc3F)cn(C)c(=O)c2n1 |
| InChI | InChI=1S/C19H15F3N6O/c1-27-8-12(16-18(19(27)29)26-28(2)25-16)11-7-10(23)3-4-15(11)24-17-13(21)5-9(20)6-14(17)22/h3-8,24H,23H2,1-2H3 |
| InChIKey | MPPKGLMLHOKKJB-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|