C22H19ClF2N5O3S2- — CID 134512824
2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]-5-(4-methyl-1,3-thiazol-2-yl)benzenesulfinate (PubChem CID 134512824) has the molecular formula C22H19ClF2N5O3S2- and a molecular weight of 539.01 g/mol. Its IUPAC name is 2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]-5-(4-methyl-1,3-thiazol-2-yl)benzenesulfinate.
| Compound Name | 2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]-5-(4-methyl-1,3-thiazol-2-yl)benzenesulfinate |
|---|---|
| PubChem CID | 134512824 |
| Molecular Formula | C22H19ClF2N5O3S2- |
| Molecular Weight | 539.01 g/mol |
| Exact Mass | 538.06 |
| IUPAC Name | 2-[[5-chloro-2-(difluoromethyl)-3-(oxan-2-yl)imidazo[4,5-b]pyridin-7-yl]amino]-5-(4-methyl-1,3-thiazol-2-yl)benzenesulfinate |
| SMILES | Cc1csc(-c2ccc(Nc3cc(Cl)nc4c3nc(C(F)F)n4C3CCCCO3)c(S(=O)[O-])c2)n1 |
| InChI | InChI=1S/C22H20ClF2N5O3S2/c1-11-10-34-22(26-11)12-5-6-13(15(8-12)35(31)32)27-14-9-16(23)28-20-18(14)29-21(19(24)25)30(20)17-4-2-3-7-33-17/h5-6,8-10,17,19H,2-4,7H2,1H3,(H,27,28)(H,31,32)/p-1 |
| InChIKey | FRIYFNCSNOVBDX-UHFFFAOYSA-M |
| XLogP | 6.13 |
| TPSA | 104.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.01 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|