C29H36ClN5O4 — CID 134512870
methyl 3-(3-chlorophenyl)-3-[[5-[(2-methylpropan-2-yl)oxymethyl]-1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrazole-4-carbonyl]amino]propanoate (PubChem CID 134512870) has the molecular formula C29H36ClN5O4 and a molecular weight of 554.09 g/mol. Its IUPAC name is methyl 3-(3-chlorophenyl)-3-[[5-[(2-methylpropan-2-yl)oxymethyl]-1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrazole-4-carbonyl]amino]propanoate.
| Compound Name | methyl 3-(3-chlorophenyl)-3-[[5-[(2-methylpropan-2-yl)oxymethyl]-1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrazole-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 134512870 |
| Molecular Formula | C29H36ClN5O4 |
| Molecular Weight | 554.09 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | methyl 3-(3-chlorophenyl)-3-[[5-[(2-methylpropan-2-yl)oxymethyl]-1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrazole-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cnn(CCc2ccc3c(n2)NCCC3)c1COC(C)(C)C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C29H36ClN5O4/c1-29(2,3)39-18-25-23(28(37)34-24(16-26(36)38-4)20-7-5-9-21(30)15-20)17-32-35(25)14-12-22-11-10-19-8-6-13-31-27(19)33-22/h5,7,9-11,15,17,24H,6,8,12-14,16,18H2,1-4H3,(H,31,33)(H,34,37) |
| InChIKey | ITTIRYYNCMJRIR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.09 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |