C30H37Cl2N5O4 — CID 134513162
methyl 3-(3,5-dichlorophenyl)-3-[[3-[(2-methylpropan-2-yl)oxymethyl]-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazole-4-carbonyl]amino]propanoate (PubChem CID 134513162) has the molecular formula C30H37Cl2N5O4 and a molecular weight of 602.56 g/mol. Its IUPAC name is methyl 3-(3,5-dichlorophenyl)-3-[[3-[(2-methylpropan-2-yl)oxymethyl]-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazole-4-carbonyl]amino]propanoate.
| Compound Name | methyl 3-(3,5-dichlorophenyl)-3-[[3-[(2-methylpropan-2-yl)oxymethyl]-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazole-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 134513162 |
| Molecular Formula | C30H37Cl2N5O4 |
| Molecular Weight | 602.56 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | methyl 3-(3,5-dichlorophenyl)-3-[[3-[(2-methylpropan-2-yl)oxymethyl]-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazole-4-carbonyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cn(CCCc2ccc3c(n2)NCCC3)nc1COC(C)(C)C)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C30H37Cl2N5O4/c1-30(2,3)41-18-26-24(29(39)35-25(16-27(38)40-4)20-13-21(31)15-22(32)14-20)17-37(36-26)12-6-8-23-10-9-19-7-5-11-33-28(19)34-23/h9-10,13-15,17,25H,5-8,11-12,16,18H2,1-4H3,(H,33,34)(H,35,39) |
| InChIKey | CFEXESAZPIHBKX-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.56 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |