C8H16IN3O — CID 134513239
(4R)-3-amino-N'-iodo-4-methylcyclohexane-1-carbohydrazide (PubChem CID 134513239) has the molecular formula C8H16IN3O and a molecular weight of 297.14 g/mol. Its IUPAC name is (4R)-3-amino-N'-iodo-4-methylcyclohexane-1-carbohydrazide.
| Compound Name | (4R)-3-amino-N'-iodo-4-methylcyclohexane-1-carbohydrazide |
|---|---|
| PubChem CID | 134513239 |
| Molecular Formula | C8H16IN3O |
| Molecular Weight | 297.14 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | (4R)-3-amino-N'-iodo-4-methylcyclohexane-1-carbohydrazide |
| SMILES | C[C@@H]1CCC(C(=O)NNI)CC1N |
| InChI | InChI=1S/C8H16IN3O/c1-5-2-3-6(4-7(5)10)8(13)11-12-9/h5-7,12H,2-4,10H2,1H3,(H,11,13)/t5-,6?,7?/m1/s1 |
| InChIKey | MKRHWCHIAKDBKN-GRQBKTHUSA-N |
| XLogP | 0.72 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.14 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|