About methyl 2,5-dimethyloctanimidate
methyl 2,5-dimethyloctanimidate (PubChem CID 134513318) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is methyl 2,5-dimethyloctanimidate.
Molecular Properties
| Compound Name | methyl 2,5-dimethyloctanimidate |
| PubChem CID | 134513318 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | methyl 2,5-dimethyloctanimidate |
| SMILES | [H]/N=C(\OC)C(C)CCC(C)CCC |
| InChI | InChI=1S/C11H23NO/c1-5-6-9(2)7-8-10(3)11(12)13-4/h9-10,12H,5-8H2,1-4H3/b12-11- |
| InChIKey | HMDLDOXYOFVKAN-QXMHVHEDSA-N |
| XLogP | 3.46 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,5-dimethyloctanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,5-dimethyloctanimidate?
The IUPAC name of methyl 2,5-dimethyloctanimidate (CID 134513318) is methyl 2,5-dimethyloctanimidate.
What is the SMILES notation for methyl 2,5-dimethyloctanimidate?
The canonical SMILES for methyl 2,5-dimethyloctanimidate is [H]/N=C(\OC)C(C)CCC(C)CCC.
What is the InChIKey of methyl 2,5-dimethyloctanimidate?
The InChIKey is HMDLDOXYOFVKAN-QXMHVHEDSA-N. The full InChI is InChI=1S/C11H23NO/c1-5-6-9(2)7-8-10(3)11(12)13-4/h9-10,12H,5-8H2,1-4H3/b12-11-.
What are the key properties of methyl 2,5-dimethyloctanimidate?
methyl 2,5-dimethyloctanimidate has a molecular weight of 185.31 g/mol, XLogP of 3.46, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,5-dimethyloctanimidate is sourced from PubChem (CID 134513318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).