C12H16N2 — CID 134513385
(3Z,5E)-5-(1,2,3,4-tetrahydropyridin-4-yl)hepta-3,5-dienenitrile (PubChem CID 134513385) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is (3Z,5E)-5-(1,2,3,4-tetrahydropyridin-4-yl)hepta-3,5-dienenitrile.
| Compound Name | (3Z,5E)-5-(1,2,3,4-tetrahydropyridin-4-yl)hepta-3,5-dienenitrile |
|---|---|
| PubChem CID | 134513385 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (3Z,5E)-5-(1,2,3,4-tetrahydropyridin-4-yl)hepta-3,5-dienenitrile |
| SMILES | C/C=C(\C=C/CC#N)C1C=CNCC1 |
| InChI | InChI=1S/C12H16N2/c1-2-11(5-3-4-8-13)12-6-9-14-10-7-12/h2-3,5-6,9,12,14H,4,7,10H2,1H3/b5-3-,11-2+ |
| InChIKey | BWVOHBKJKBGSJX-CQOFMZFUSA-N |
| XLogP | 2.53 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|