C36H41NO9 — CID 134513408
1-O-[(2S,3S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-methyl-4-phenylmethoxypent-2-ynyl)butanedioate (PubChem CID 134513408) has the molecular formula C36H41NO9 and a molecular weight of 631.72 g/mol. Its IUPAC name is 1-O-[(2S,3S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-methyl-4-phenylmethoxypent-2-ynyl)butanedioate.
| Compound Name | 1-O-[(2S,3S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-methyl-4-phenylmethoxypent-2-ynyl)butanedioate |
|---|---|
| PubChem CID | 134513408 |
| Molecular Formula | C36H41NO9 |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.28 |
| IUPAC Name | 1-O-[(2S,3S)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-(4-methyl-4-phenylmethoxypent-2-ynyl)butanedioate |
| SMILES | COC(=O)C[C@](O)(CC#CC(C)(C)OCc1ccccc1)C(=O)O[C@@H]1C(OC)=CC23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| InChI | InChI=1S/C36H41NO9/c1-34(2,45-22-24-10-6-5-7-11-24)13-8-15-36(40,21-30(38)42-4)33(39)46-32-29(41-3)20-35-14-9-16-37(35)17-12-25-18-27-28(44-23-43-27)19-26(25)31(32)35/h5-7,10-11,18-20,31-32,40H,9,12,14-17,21-23H2,1-4H3/t31-,32-,35?,36-/m1/s1 |
| InChIKey | ROYCSKSITUUHIM-PEJDJHECSA-N |
| XLogP | 4.03 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|