C11H19N — CID 134513595
(2E,4Z)-6-methyl-N-propylhepta-2,4,6-trien-2-amine (PubChem CID 134513595) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is (2E,4Z)-6-methyl-N-propylhepta-2,4,6-trien-2-amine.
| Compound Name | (2E,4Z)-6-methyl-N-propylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 134513595 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | (2E,4Z)-6-methyl-N-propylhepta-2,4,6-trien-2-amine |
| SMILES | C=C(C)/C=C\C=C(/C)NCCC |
| InChI | InChI=1S/C11H19N/c1-5-9-12-11(4)8-6-7-10(2)3/h6-8,12H,2,5,9H2,1,3-4H3/b7-6-,11-8+ |
| InChIKey | QSWBRWAIYLKHBV-BQGCWICQSA-N |
| XLogP | 3.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|