C22H20FN3O — CID 134514167
(5S)-10-amino-7-(4-fluorophenyl)-2,5,9-trimethyl-5H-pyrido[4,3-d][2]benzazepin-3-one (PubChem CID 134514167) has the molecular formula C22H20FN3O and a molecular weight of 361.42 g/mol. Its IUPAC name is (5S)-10-amino-7-(4-fluorophenyl)-2,5,9-trimethyl-5H-pyrido[4,3-d][2]benzazepin-3-one.
| Compound Name | (5S)-10-amino-7-(4-fluorophenyl)-2,5,9-trimethyl-5H-pyrido[4,3-d][2]benzazepin-3-one |
|---|---|
| PubChem CID | 134514167 |
| Molecular Formula | C22H20FN3O |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | (5S)-10-amino-7-(4-fluorophenyl)-2,5,9-trimethyl-5H-pyrido[4,3-d][2]benzazepin-3-one |
| SMILES | Cc1cc2c(cc1N)-c1cn(C)c(=O)cc1[C@H](C)N=C2c1ccc(F)cc1 |
| InChI | InChI=1S/C22H20FN3O/c1-12-8-18-17(9-20(12)24)19-11-26(3)21(27)10-16(19)13(2)25-22(18)14-4-6-15(23)7-5-14/h4-11,13H,24H2,1-3H3/t13-/m0/s1 |
| InChIKey | SSBKSJGRTCCOKL-ZDUSSCGKSA-N |
| XLogP | 3.99 |
| TPSA | 60.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|