C15H14F3N5O2 — CID 134514286
3-[[[5-amino-2-[2-(trifluoromethoxy)ethoxy]pyrimidin-4-yl]amino]methyl]benzonitrile (PubChem CID 134514286) has the molecular formula C15H14F3N5O2 and a molecular weight of 353.30 g/mol. Its IUPAC name is 3-[[[5-amino-2-[2-(trifluoromethoxy)ethoxy]pyrimidin-4-yl]amino]methyl]benzonitrile.
| Compound Name | 3-[[[5-amino-2-[2-(trifluoromethoxy)ethoxy]pyrimidin-4-yl]amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 134514286 |
| Molecular Formula | C15H14F3N5O2 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 3-[[[5-amino-2-[2-(trifluoromethoxy)ethoxy]pyrimidin-4-yl]amino]methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNc2nc(OCCOC(F)(F)F)ncc2N)c1 |
| InChI | InChI=1S/C15H14F3N5O2/c16-15(17,18)25-5-4-24-14-22-9-12(20)13(23-14)21-8-11-3-1-2-10(6-11)7-19/h1-3,6,9H,4-5,8,20H2,(H,21,22,23) |
| InChIKey | IYHJRFYQFWWFOL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|