About 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane
7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane (PubChem CID 134514853) has the molecular formula C22H45FO
and a molecular weight of 344.60 g/mol. Its IUPAC name is 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane.
Molecular Properties
| Compound Name | 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane |
| PubChem CID | 134514853 |
| Molecular Formula | C22H45FO |
| Molecular Weight | 344.60 g/mol |
| Exact Mass | 344.35 |
| IUPAC Name | 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane |
| SMILES | CCCCCCC(CCCCCC)C(C)OC(C)CC(C)(C)CF |
| InChI | InChI=1S/C22H45FO/c1-7-9-11-13-15-21(16-14-12-10-8-2)20(4)24-19(3)17-22(5,6)18-23/h19-21H,7-18H2,1-6H3 |
| InChIKey | VYNZPOGSMNGZAX-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.60 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane?
The IUPAC name of 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane (CID 134514853) is 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane.
What is the SMILES notation for 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane?
The canonical SMILES for 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane is CCCCCCC(CCCCCC)C(C)OC(C)CC(C)(C)CF.
What is the InChIKey of 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane?
The InChIKey is VYNZPOGSMNGZAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H45FO/c1-7-9-11-13-15-21(16-14-12-10-8-2)20(4)24-19(3)17-22(5,6)18-23/h19-21H,7-18H2,1-6H3.
What are the key properties of 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane?
7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane has a molecular weight of 344.60 g/mol, XLogP of 7.72, 16 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[1-(5-fluoro-4,4-dimethylpentan-2-yl)oxyethyl]tridecane is sourced from PubChem (CID 134514853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).