About (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione
(2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione (PubChem CID 134514904) has the molecular formula C14H19NS2
and a molecular weight of 265.45 g/mol. Its IUPAC name is (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione.
Molecular Properties
| Compound Name | (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione |
| PubChem CID | 134514904 |
| Molecular Formula | C14H19NS2 |
| Molecular Weight | 265.45 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione |
| SMILES | C/C=c1/sc(C)c(/C=C\CNC)c(=S)/c1=C/C |
| InChI | InChI=1S/C14H19NS2/c1-5-11-13(6-2)17-10(3)12(14(11)16)8-7-9-15-4/h5-8,15H,9H2,1-4H3/b8-7-,11-5+,13-6+ |
| InChIKey | YPVAGPPXMYFRLD-SFOXGDPUSA-N |
| XLogP | 2.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione?
The IUPAC name of (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione (CID 134514904) is (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione.
What is the SMILES notation for (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione?
The canonical SMILES for (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione is C/C=c1/sc(C)c(/C=C\CNC)c(=S)/c1=C/C.
What is the InChIKey of (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione?
The InChIKey is YPVAGPPXMYFRLD-SFOXGDPUSA-N. The full InChI is InChI=1S/C14H19NS2/c1-5-11-13(6-2)17-10(3)12(14(11)16)8-7-9-15-4/h5-8,15H,9H2,1-4H3/b8-7-,11-5+,13-6+.
What are the key properties of (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione?
(2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione has a molecular weight of 265.45 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-2,3-di(ethylidene)-6-methyl-5-[(Z)-3-(methylamino)prop-1-enyl]thiopyran-4-thione is sourced from PubChem (CID 134514904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).