C21H42N2O — CID 134515047
1-methyl-4-[3,3,6,6-tetramethyl-7-(oxan-2-yl)heptyl]piperazine (PubChem CID 134515047) has the molecular formula C21H42N2O and a molecular weight of 338.58 g/mol. Its IUPAC name is 1-methyl-4-[3,3,6,6-tetramethyl-7-(oxan-2-yl)heptyl]piperazine.
| Compound Name | 1-methyl-4-[3,3,6,6-tetramethyl-7-(oxan-2-yl)heptyl]piperazine |
|---|---|
| PubChem CID | 134515047 |
| Molecular Formula | C21H42N2O |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.33 |
| IUPAC Name | 1-methyl-4-[3,3,6,6-tetramethyl-7-(oxan-2-yl)heptyl]piperazine |
| SMILES | CN1CCN(CCC(C)(C)CCC(C)(C)CC2CCCCO2)CC1 |
| InChI | InChI=1S/C21H42N2O/c1-20(2,11-12-23-15-13-22(5)14-16-23)9-10-21(3,4)18-19-8-6-7-17-24-19/h19H,6-18H2,1-5H3 |
| InChIKey | XLRBJDZKHIINAR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |