About 1,4-dimethyl-2H-pyrazolo[3,4-b]indole
1,4-dimethyl-2H-pyrazolo[3,4-b]indole (PubChem CID 134515346) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1,4-dimethyl-2H-pyrazolo[3,4-b]indole.
Molecular Properties
| Compound Name | 1,4-dimethyl-2H-pyrazolo[3,4-b]indole |
| PubChem CID | 134515346 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1,4-dimethyl-2H-pyrazolo[3,4-b]indole |
| SMILES | Cc1[nH]nc2c1c1ccccc1n2C |
| InChI | InChI=1S/C11H11N3/c1-7-10-8-5-3-4-6-9(8)14(2)11(10)13-12-7/h3-6H,1-2H3,(H,12,13) |
| InChIKey | UQHXAUWVUQENKE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dimethyl-2H-pyrazolo[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2H-pyrazolo[3,4-b]indole?
The IUPAC name of 1,4-dimethyl-2H-pyrazolo[3,4-b]indole (CID 134515346) is 1,4-dimethyl-2H-pyrazolo[3,4-b]indole.
What is the SMILES notation for 1,4-dimethyl-2H-pyrazolo[3,4-b]indole?
The canonical SMILES for 1,4-dimethyl-2H-pyrazolo[3,4-b]indole is Cc1[nH]nc2c1c1ccccc1n2C.
What is the InChIKey of 1,4-dimethyl-2H-pyrazolo[3,4-b]indole?
The InChIKey is UQHXAUWVUQENKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c1-7-10-8-5-3-4-6-9(8)14(2)11(10)13-12-7/h3-6H,1-2H3,(H,12,13).
What are the key properties of 1,4-dimethyl-2H-pyrazolo[3,4-b]indole?
1,4-dimethyl-2H-pyrazolo[3,4-b]indole has a molecular weight of 185.23 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2H-pyrazolo[3,4-b]indole is sourced from PubChem (CID 134515346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).