C21H20F3N5O2 — CID 134515674
N-[4-[(4R)-4-methyl-6-oxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropyridazin-3-yl]phenyl]-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide (PubChem CID 134515674) has the molecular formula C21H20F3N5O2 and a molecular weight of 431.42 g/mol. Its IUPAC name is N-[4-[(4R)-4-methyl-6-oxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropyridazin-3-yl]phenyl]-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide.
| Compound Name | N-[4-[(4R)-4-methyl-6-oxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropyridazin-3-yl]phenyl]-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 134515674 |
| Molecular Formula | C21H20F3N5O2 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | N-[4-[(4R)-4-methyl-6-oxo-1-(2,2,2-trifluoroethyl)-4,5-dihydropyridazin-3-yl]phenyl]-5,7-dihydropyrrolo[3,4-b]pyridine-6-carboxamide |
| SMILES | C[C@@H]1CC(=O)N(CC(F)(F)F)N=C1c1ccc(NC(=O)N2Cc3cccnc3C2)cc1 |
| InChI | InChI=1S/C21H20F3N5O2/c1-13-9-18(30)29(12-21(22,23)24)27-19(13)14-4-6-16(7-5-14)26-20(31)28-10-15-3-2-8-25-17(15)11-28/h2-8,13H,9-12H2,1H3,(H,26,31)/t13-/m1/s1 |
| InChIKey | CZBNTEZFAYLIML-CYBMUJFWSA-N |
| XLogP | 3.76 |
| TPSA | 77.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |