About 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole
2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole (PubChem CID 134516259) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole.
Molecular Properties
| Compound Name | 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole |
| PubChem CID | 134516259 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole |
| SMILES | C=C=Cc1c(C)c(C)c(C=C)n1C |
| InChI | InChI=1S/C12H15N/c1-6-8-12-10(4)9(3)11(7-2)13(12)5/h7-8H,1-2H2,3-5H3 |
| InChIKey | QSYUGMCPOVVQMG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole?
The IUPAC name of 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole (CID 134516259) is 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole.
What is the SMILES notation for 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole?
The canonical SMILES for 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole is C=C=Cc1c(C)c(C)c(C=C)n1C.
What is the InChIKey of 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole?
The InChIKey is QSYUGMCPOVVQMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N/c1-6-8-12-10(4)9(3)11(7-2)13(12)5/h7-8H,1-2H2,3-5H3.
What are the key properties of 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole?
2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole has a molecular weight of 173.26 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenyl-1,3,4-trimethyl-5-propa-1,2-dienylpyrrole is sourced from PubChem (CID 134516259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).