C25H34N6O — CID 134516412
1-[3,4-dimethyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-7-yl]-N-pentylpiperidine-4-carboxamide (PubChem CID 134516412) has the molecular formula C25H34N6O and a molecular weight of 434.59 g/mol. Its IUPAC name is 1-[3,4-dimethyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-7-yl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[3,4-dimethyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-7-yl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 134516412 |
| Molecular Formula | C25H34N6O |
| Molecular Weight | 434.59 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 1-[3,4-dimethyl-2-(4-methylphenyl)pyrazolo[3,4-d]pyridazin-7-yl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(c2nnc(C)c3c(C)n(-c4ccc(C)cc4)nc23)CC1 |
| InChI | InChI=1S/C25H34N6O/c1-5-6-7-14-26-25(32)20-12-15-30(16-13-20)24-23-22(18(3)27-28-24)19(4)31(29-23)21-10-8-17(2)9-11-21/h8-11,20H,5-7,12-16H2,1-4H3,(H,26,32) |
| InChIKey | ICAJBGBCTUGUJJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.59 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|